C12H16Cl2FN — CID 102859934
1-chloro-N-[(3-chloro-2-fluorophenyl)methyl]-N,2-dimethylpropan-2-amine (PubChem CID 102859934) has the molecular formula C12H16Cl2FN and a molecular weight of 264.17 g/mol. Its IUPAC name is 1-chloro-N-[(3-chloro-2-fluorophenyl)methyl]-N,2-dimethylpropan-2-amine.
| Compound Name | 1-chloro-N-[(3-chloro-2-fluorophenyl)methyl]-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 102859934 |
| Molecular Formula | C12H16Cl2FN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 1-chloro-N-[(3-chloro-2-fluorophenyl)methyl]-N,2-dimethylpropan-2-amine |
| SMILES | CN(Cc1cccc(Cl)c1F)C(C)(C)CCl |
| InChI | InChI=1S/C12H16Cl2FN/c1-12(2,8-13)16(3)7-9-5-4-6-10(14)11(9)15/h4-6H,7-8H2,1-3H3 |
| InChIKey | PCDBUFMRPDKUBX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|