C12H16ClF2N — CID 105409089
1-chloro-N-[(3,5-difluorophenyl)methyl]-N,2-dimethylpropan-2-amine (PubChem CID 105409089) has the molecular formula C12H16ClF2N and a molecular weight of 247.72 g/mol. Its IUPAC name is 1-chloro-N-[(3,5-difluorophenyl)methyl]-N,2-dimethylpropan-2-amine.
| Compound Name | 1-chloro-N-[(3,5-difluorophenyl)methyl]-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 105409089 |
| Molecular Formula | C12H16ClF2N |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1-chloro-N-[(3,5-difluorophenyl)methyl]-N,2-dimethylpropan-2-amine |
| SMILES | CN(Cc1cc(F)cc(F)c1)C(C)(C)CCl |
| InChI | InChI=1S/C12H16ClF2N/c1-12(2,8-13)16(3)7-9-4-10(14)6-11(15)5-9/h4-6H,7-8H2,1-3H3 |
| InChIKey | DVOSGOQQSCEZQI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|