C14H20ClF2N — CID 105408917
N-(2-chloroethyl)-N-[(3,5-difluorophenyl)methyl]pentan-3-amine (PubChem CID 105408917) has the molecular formula C14H20ClF2N and a molecular weight of 275.77 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(3,5-difluorophenyl)methyl]pentan-3-amine.
| Compound Name | N-(2-chloroethyl)-N-[(3,5-difluorophenyl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 105408917 |
| Molecular Formula | C14H20ClF2N |
| Molecular Weight | 275.77 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2-chloroethyl)-N-[(3,5-difluorophenyl)methyl]pentan-3-amine |
| SMILES | CCC(CC)N(CCCl)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H20ClF2N/c1-3-14(4-2)18(6-5-15)10-11-7-12(16)9-13(17)8-11/h7-9,14H,3-6,10H2,1-2H3 |
| InChIKey | RYPFSZFVCXETQJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|