C13H19ClFN — CID 106530471
3-(chloromethyl)-5-fluoro-N-methyl-N-(2-methylbutan-2-yl)aniline (PubChem CID 106530471) has the molecular formula C13H19ClFN and a molecular weight of 243.75 g/mol. Its IUPAC name is 3-(chloromethyl)-5-fluoro-N-methyl-N-(2-methylbutan-2-yl)aniline.
| Compound Name | 3-(chloromethyl)-5-fluoro-N-methyl-N-(2-methylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 106530471 |
| Molecular Formula | C13H19ClFN |
| Molecular Weight | 243.75 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-(chloromethyl)-5-fluoro-N-methyl-N-(2-methylbutan-2-yl)aniline |
| SMILES | CCC(C)(C)N(C)c1cc(F)cc(CCl)c1 |
| InChI | InChI=1S/C13H19ClFN/c1-5-13(2,3)16(4)12-7-10(9-14)6-11(15)8-12/h6-8H,5,9H2,1-4H3 |
| InChIKey | VJUCHHYAENVJQA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.75 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|