C12H12ClF4N — CID 106530398
3-(chloromethyl)-N-cyclopropyl-5-fluoro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 106530398) has the molecular formula C12H12ClF4N and a molecular weight of 281.68 g/mol. Its IUPAC name is 3-(chloromethyl)-N-cyclopropyl-5-fluoro-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 3-(chloromethyl)-N-cyclopropyl-5-fluoro-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 106530398 |
| Molecular Formula | C12H12ClF4N |
| Molecular Weight | 281.68 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-(chloromethyl)-N-cyclopropyl-5-fluoro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | Fc1cc(CCl)cc(N(CC(F)(F)F)C2CC2)c1 |
| InChI | InChI=1S/C12H12ClF4N/c13-6-8-3-9(14)5-11(4-8)18(10-1-2-10)7-12(15,16)17/h3-5,10H,1-2,6-7H2 |
| InChIKey | NMSGWNSRZDZHEQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.68 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|