C15H16FNO2 — CID 106529823
[3-[cyclopropyl(furan-2-ylmethyl)amino]-5-fluorophenyl]methanol (PubChem CID 106529823) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is [3-[cyclopropyl(furan-2-ylmethyl)amino]-5-fluorophenyl]methanol.
| Compound Name | [3-[cyclopropyl(furan-2-ylmethyl)amino]-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 106529823 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [3-[cyclopropyl(furan-2-ylmethyl)amino]-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)cc(N(Cc2ccco2)C2CC2)c1 |
| InChI | InChI=1S/C15H16FNO2/c16-12-6-11(10-18)7-14(8-12)17(13-3-4-13)9-15-2-1-5-19-15/h1-2,5-8,13,18H,3-4,9-10H2 |
| InChIKey | BTYTYONROGBKSV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |