C15H15NO2 — CID 55003500
4-[cyclopropyl(furan-2-ylmethyl)amino]benzaldehyde (PubChem CID 55003500) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[cyclopropyl(furan-2-ylmethyl)amino]benzaldehyde.
| Compound Name | 4-[cyclopropyl(furan-2-ylmethyl)amino]benzaldehyde |
|---|---|
| PubChem CID | 55003500 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[cyclopropyl(furan-2-ylmethyl)amino]benzaldehyde |
| SMILES | O=Cc1ccc(N(Cc2ccco2)C2CC2)cc1 |
| InChI | InChI=1S/C15H15NO2/c17-11-12-3-5-13(6-4-12)16(14-7-8-14)10-15-2-1-9-18-15/h1-6,9,11,14H,7-8,10H2 |
| InChIKey | SXKCQYISHDGUGL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|