C12H11F3N2 — CID 102815940
3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile (PubChem CID 102815940) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile.
| Compound Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 102815940 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile |
| SMILES | N#Cc1cccc(N(CC(F)(F)F)C2CC2)c1 |
| InChI | InChI=1S/C12H11F3N2/c13-12(14,15)8-17(10-4-5-10)11-3-1-2-9(6-11)7-16/h1-3,6,10H,4-5,8H2 |
| InChIKey | BGXDRQXMHPMHTD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |