About 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile
3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile (PubChem CID 102815940) has the molecular formula C12H11F3N2
and a molecular weight of 240.23 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile.
Molecular Properties
| Compound Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile |
| PubChem CID | 102815940 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile |
| SMILES | N#Cc1cccc(N(CC(F)(F)F)C2CC2)c1 |
| InChI | InChI=1S/C12H11F3N2/c13-12(14,15)8-17(10-4-5-10)11-3-1-2-9(6-11)7-16/h1-3,6,10H,4-5,8H2 |
| InChIKey | BGXDRQXMHPMHTD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile?
The IUPAC name of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile (CID 102815940) is 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile.
What is the SMILES notation for 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile?
The canonical SMILES for 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile is N#Cc1cccc(N(CC(F)(F)F)C2CC2)c1.
What is the InChIKey of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile?
The InChIKey is BGXDRQXMHPMHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3N2/c13-12(14,15)8-17(10-4-5-10)11-3-1-2-9(6-11)7-16/h1-3,6,10H,4-5,8H2.
What are the key properties of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile?
3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile has a molecular weight of 240.23 g/mol, XLogP of 3.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]benzonitrile is sourced from PubChem (CID 102815940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).