C19H21F3 — CID 134214905
(2-ethyl-1,1,1-trifluoro-4-phenylpentan-2-yl)benzene (PubChem CID 134214905) has the molecular formula C19H21F3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2-ethyl-1,1,1-trifluoro-4-phenylpentan-2-yl)benzene.
| Compound Name | (2-ethyl-1,1,1-trifluoro-4-phenylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 134214905 |
| Molecular Formula | C19H21F3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2-ethyl-1,1,1-trifluoro-4-phenylpentan-2-yl)benzene |
| SMILES | CCC(CC(C)c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H21F3/c1-3-18(19(20,21)22,17-12-8-5-9-13-17)14-15(2)16-10-6-4-7-11-16/h4-13,15H,3,14H2,1-2H3 |
| InChIKey | BDSXQQCAYPSPMN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |