C13H21ClN2 — CID 84752651
1-(4-chlorophenyl)-2-N',2-N'-diethylpropane-2,2-diamine (PubChem CID 84752651) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-N',2-N'-diethylpropane-2,2-diamine.
| Compound Name | 1-(4-chlorophenyl)-2-N',2-N'-diethylpropane-2,2-diamine |
|---|---|
| PubChem CID | 84752651 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(4-chlorophenyl)-2-N',2-N'-diethylpropane-2,2-diamine |
| SMILES | CCN(CC)C(C)(N)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H21ClN2/c1-4-16(5-2)13(3,15)10-11-6-8-12(14)9-7-11/h6-9H,4-5,10,15H2,1-3H3 |
| InChIKey | JDNJTRQNBAMFIL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|