C18H30ClN — CID 139644714
N,N-dibutyl-1-(4-chlorophenyl)-2-methylpropan-2-amine (PubChem CID 139644714) has the molecular formula C18H30ClN and a molecular weight of 295.90 g/mol. Its IUPAC name is N,N-dibutyl-1-(4-chlorophenyl)-2-methylpropan-2-amine.
| Compound Name | N,N-dibutyl-1-(4-chlorophenyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 139644714 |
| Molecular Formula | C18H30ClN |
| Molecular Weight | 295.90 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | N,N-dibutyl-1-(4-chlorophenyl)-2-methylpropan-2-amine |
| SMILES | CCCCN(CCCC)C(C)(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H30ClN/c1-5-7-13-20(14-8-6-2)18(3,4)15-16-9-11-17(19)12-10-16/h9-12H,5-8,13-15H2,1-4H3 |
| InChIKey | NJNSHGWUTYIRJZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.90 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |