C19H26O3S — CID 101270787
ethyl 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetate (PubChem CID 101270787) has the molecular formula C19H26O3S and a molecular weight of 334.48 g/mol. Its IUPAC name is ethyl 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetate.
| Compound Name | ethyl 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetate |
|---|---|
| PubChem CID | 101270787 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetate |
| SMILES | CCOC(=O)C[C@@]12CCC[C@@H]1CC[C@H](Sc1ccc(C)cc1)O2 |
| InChI | InChI=1S/C19H26O3S/c1-3-21-17(20)13-19-12-4-5-15(19)8-11-18(22-19)23-16-9-6-14(2)7-10-16/h6-7,9-10,15,18H,3-5,8,11-13H2,1-2H3/t15-,18+,19+/m1/s1 |
| InChIKey | XIMMXRXKFJRLER-MNEFBYGVSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |