C17H21ClO2S — CID 134877190
2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetyl chloride (PubChem CID 134877190) has the molecular formula C17H21ClO2S and a molecular weight of 324.87 g/mol. Its IUPAC name is 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetyl chloride.
| Compound Name | 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetyl chloride |
|---|---|
| PubChem CID | 134877190 |
| Molecular Formula | C17H21ClO2S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[(2S,4aR,7aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,7-hexahydro-2H-cyclopenta[b]pyran-7a-yl]acetyl chloride |
| SMILES | Cc1ccc(S[C@H]2CC[C@H]3CCC[C@@]3(CC(=O)Cl)O2)cc1 |
| InChI | InChI=1S/C17H21ClO2S/c1-12-4-7-14(8-5-12)21-16-9-6-13-3-2-10-17(13,20-16)11-15(18)19/h4-5,7-8,13,16H,2-3,6,9-11H2,1H3/t13-,16+,17+/m1/s1 |
| InChIKey | WDRAOZAFOYYOBQ-COXVUDFISA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|