C18H22O2S — CID 102595408
(2S,4aR,6aR,9aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,6a,7,9-octahydro-2H-pentaleno[6a,1-b]pyran-8-one (PubChem CID 102595408) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is (2S,4aR,6aR,9aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,6a,7,9-octahydro-2H-pentaleno[6a,1-b]pyran-8-one.
| Compound Name | (2S,4aR,6aR,9aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,6a,7,9-octahydro-2H-pentaleno[6a,1-b]pyran-8-one |
|---|---|
| PubChem CID | 102595408 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2S,4aR,6aR,9aS)-2-(4-methylphenyl)sulfanyl-3,4,4a,5,6,6a,7,9-octahydro-2H-pentaleno[6a,1-b]pyran-8-one |
| SMILES | Cc1ccc(S[C@H]2CC[C@H]3CC[C@@H]4CC(=O)C[C@]34O2)cc1 |
| InChI | InChI=1S/C18H22O2S/c1-12-2-7-16(8-3-12)21-17-9-6-13-4-5-14-10-15(19)11-18(13,14)20-17/h2-3,7-8,13-14,17H,4-6,9-11H2,1H3/t13-,14-,17+,18+/m1/s1 |
| InChIKey | VQMAVQOOHHMZBF-KNCCTNLNSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |