C18H24O3S — CID 102397204
ethyl 2-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]acetate (PubChem CID 102397204) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is ethyl 2-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]acetate.
| Compound Name | ethyl 2-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]acetate |
|---|---|
| PubChem CID | 102397204 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl 2-[(2R,3aR,6aS)-2-(4-methylphenyl)sulfanyl-2,3,3a,4,5,6-hexahydrocyclopenta[b]furan-6a-yl]acetate |
| SMILES | CCOC(=O)C[C@@]12CCC[C@@H]1C[C@@H](Sc1ccc(C)cc1)O2 |
| InChI | InChI=1S/C18H24O3S/c1-3-20-16(19)12-18-10-4-5-14(18)11-17(21-18)22-15-8-6-13(2)7-9-15/h6-9,14,17H,3-5,10-12H2,1-2H3/t14-,17-,18+/m1/s1 |
| InChIKey | UWHNEGFSFGUFGG-OLMNPRSZSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |