C16H20O5S — CID 15395818
methyl 2-[(2S,3R,3aS,6aR)-3-(benzenesulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]acetate (PubChem CID 15395818) has the molecular formula C16H20O5S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl 2-[(2S,3R,3aS,6aR)-3-(benzenesulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,3aS,6aR)-3-(benzenesulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]acetate |
|---|---|
| PubChem CID | 15395818 |
| Molecular Formula | C16H20O5S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | methyl 2-[(2S,3R,3aS,6aR)-3-(benzenesulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@@H]2CCC[C@@H]2[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O5S/c1-20-15(17)10-14-16(12-8-5-9-13(12)21-14)22(18,19)11-6-3-2-4-7-11/h2-4,6-7,12-14,16H,5,8-10H2,1H3/t12-,13+,14-,16+/m0/s1 |
| InChIKey | WTXQTCSTDLOZSF-KNCOVGOOSA-N |
| XLogP | 1.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |