C16H16O2S — CID 11065588
(1R,5R,8S)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one (PubChem CID 11065588) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is (1R,5R,8S)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one.
| Compound Name | (1R,5R,8S)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 11065588 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (1R,5R,8S)-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one |
| SMILES | O=C1C(Sc2ccccc2)[C@@H]2C=C[C@@]3(CCC[C@@H]13)O2 |
| InChI | InChI=1S/C16H16O2S/c17-14-12-7-4-9-16(12)10-8-13(18-16)15(14)19-11-5-2-1-3-6-11/h1-3,5-6,8,10,12-13,15H,4,7,9H2/t12-,13-,15?,16+/m0/s1 |
| InChIKey | SATWFEGHKHBCON-CMHZKVDGSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|