C22H26O2S — CID 11046448
(1R,4R,5R,9R)-9-but-3-enyl-4-(phenylsulfanylmethyl)-12-oxatricyclo[7.2.1.01,5]dodec-10-en-7-one (PubChem CID 11046448) has the molecular formula C22H26O2S and a molecular weight of 354.51 g/mol. Its IUPAC name is (1R,4R,5R,9R)-9-but-3-enyl-4-(phenylsulfanylmethyl)-12-oxatricyclo[7.2.1.01,5]dodec-10-en-7-one.
| Compound Name | (1R,4R,5R,9R)-9-but-3-enyl-4-(phenylsulfanylmethyl)-12-oxatricyclo[7.2.1.01,5]dodec-10-en-7-one |
|---|---|
| PubChem CID | 11046448 |
| Molecular Formula | C22H26O2S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (1R,4R,5R,9R)-9-but-3-enyl-4-(phenylsulfanylmethyl)-12-oxatricyclo[7.2.1.01,5]dodec-10-en-7-one |
| SMILES | C=CCC[C@]12C=C[C@@]3(CC[C@@H](CSc4ccccc4)[C@H]3CC(=O)C1)O2 |
| InChI | InChI=1S/C22H26O2S/c1-2-3-10-21-12-13-22(24-21)11-9-17(20(22)14-18(23)15-21)16-25-19-7-5-4-6-8-19/h2,4-8,12-13,17,20H,1,3,9-11,14-16H2/t17-,20+,21-,22+/m0/s1 |
| InChIKey | UEKDHPIZEITTIY-KVJIRVJXSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|