C23H28O4S — CID 101057106
(1R,5R,6R,9S,12R)-6-methyl-12-[(4-methylphenyl)sulfonylmethyl]-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-10-en-3-one (PubChem CID 101057106) has the molecular formula C23H28O4S and a molecular weight of 400.54 g/mol. Its IUPAC name is (1R,5R,6R,9S,12R)-6-methyl-12-[(4-methylphenyl)sulfonylmethyl]-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-10-en-3-one.
| Compound Name | (1R,5R,6R,9S,12R)-6-methyl-12-[(4-methylphenyl)sulfonylmethyl]-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-10-en-3-one |
|---|---|
| PubChem CID | 101057106 |
| Molecular Formula | C23H28O4S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (1R,5R,6R,9S,12R)-6-methyl-12-[(4-methylphenyl)sulfonylmethyl]-15-oxatetracyclo[7.5.1.01,11.05,9]pentadec-10-en-3-one |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2CC[C@@]34CC(=O)C[C@@H]5[C@H](C)CC[C@]5(C=C23)O4)cc1 |
| InChI | InChI=1S/C23H28O4S/c1-15-3-5-19(6-4-15)28(25,26)14-17-8-10-22-12-18(24)11-20-16(2)7-9-23(20,27-22)13-21(17)22/h3-6,13,16-17,20H,7-12,14H2,1-2H3/t16-,17+,20-,22-,23-/m1/s1 |
| InChIKey | WXHOLODBLVTOSO-FVHUDHBUSA-N |
| XLogP | 4.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|