C17H18O2S — CID 15723424
(1R,5R,8S)-5-methyl-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one (PubChem CID 15723424) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is (1R,5R,8S)-5-methyl-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one.
| Compound Name | (1R,5R,8S)-5-methyl-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one |
|---|---|
| PubChem CID | 15723424 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (1R,5R,8S)-5-methyl-7-phenylsulfanyl-11-oxatricyclo[6.2.1.01,5]undec-9-en-6-one |
| SMILES | C[C@@]12CCC[C@@]13C=C[C@H](O3)C(Sc1ccccc1)C2=O |
| InChI | InChI=1S/C17H18O2S/c1-16-9-5-10-17(16)11-8-13(19-17)14(15(16)18)20-12-6-3-2-4-7-12/h2-4,6-8,11,13-14H,5,9-10H2,1H3/t13-,14?,16-,17+/m0/s1 |
| InChIKey | CHIDJBZSSWGZNX-YTTRVJOFSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|