C21H26O2S — CID 11393732
(1S,6S,8R,9S)-2,2,6,9-tetramethyl-8-phenylsulfanyl-12-oxatricyclo[7.2.1.01,6]dodec-10-en-7-one (PubChem CID 11393732) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is (1S,6S,8R,9S)-2,2,6,9-tetramethyl-8-phenylsulfanyl-12-oxatricyclo[7.2.1.01,6]dodec-10-en-7-one.
| Compound Name | (1S,6S,8R,9S)-2,2,6,9-tetramethyl-8-phenylsulfanyl-12-oxatricyclo[7.2.1.01,6]dodec-10-en-7-one |
|---|---|
| PubChem CID | 11393732 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (1S,6S,8R,9S)-2,2,6,9-tetramethyl-8-phenylsulfanyl-12-oxatricyclo[7.2.1.01,6]dodec-10-en-7-one |
| SMILES | CC1(C)CCC[C@]2(C)C(=O)[C@H](Sc3ccccc3)[C@]3(C)C=C[C@]12O3 |
| InChI | InChI=1S/C21H26O2S/c1-18(2)11-8-12-19(3)16(22)17(24-15-9-6-5-7-10-15)20(4)13-14-21(18,19)23-20/h5-7,9-10,13-14,17H,8,11-12H2,1-4H3/t17-,19+,20-,21-/m0/s1 |
| InChIKey | BHXLVPGKPMXNDG-NRDMVMEKSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|