C16H18O2S — CID 177423335
(1S,6S)-1,6-dimethyl-5-phenylsulfanyl-9-oxabicyclo[4.2.1]non-7-en-3-one (PubChem CID 177423335) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is (1S,6S)-1,6-dimethyl-5-phenylsulfanyl-9-oxabicyclo[4.2.1]non-7-en-3-one.
| Compound Name | (1S,6S)-1,6-dimethyl-5-phenylsulfanyl-9-oxabicyclo[4.2.1]non-7-en-3-one |
|---|---|
| PubChem CID | 177423335 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1S,6S)-1,6-dimethyl-5-phenylsulfanyl-9-oxabicyclo[4.2.1]non-7-en-3-one |
| SMILES | C[C@]12C=C[C@](C)(O1)C(Sc1ccccc1)CC(=O)C2 |
| InChI | InChI=1S/C16H18O2S/c1-15-8-9-16(2,18-15)14(10-12(17)11-15)19-13-6-4-3-5-7-13/h3-9,14H,10-11H2,1-2H3/t14?,15-,16+/m1/s1 |
| InChIKey | AREQBWBOTMDZPH-JAIYHHTPSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|