C14H14O2S — CID 138975546
(1R,2S,5R)-1-methyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 138975546) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is (1R,2S,5R)-1-methyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,5R)-1-methyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 138975546 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (1R,2S,5R)-1-methyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@]12C=C[C@@H](CC(=O)[C@H]1Sc1ccccc1)O2 |
| InChI | InChI=1S/C14H14O2S/c1-14-8-7-10(16-14)9-12(15)13(14)17-11-5-3-2-4-6-11/h2-8,10,13H,9H2,1H3/t10-,13+,14+/m0/s1 |
| InChIKey | MDYRUPQXIVNYRS-ZLKJLUDKSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|