C15H16O2S — CID 138975730
(1R,2S,5R)-1,5-dimethyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 138975730) has the molecular formula C15H16O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is (1R,2S,5R)-1,5-dimethyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,5R)-1,5-dimethyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 138975730 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (1R,2S,5R)-1,5-dimethyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@]12C=C[C@@](C)(O1)[C@H](Sc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C15H16O2S/c1-14-8-9-15(2,17-14)13(12(16)10-14)18-11-6-4-3-5-7-11/h3-9,13H,10H2,1-2H3/t13-,14+,15-/m1/s1 |
| InChIKey | PKGDBHUYYLQVEF-QLFBSQMISA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|