C16H18OS — CID 102367652
(1R,2R,5R)-1,5-dimethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene (PubChem CID 102367652) has the molecular formula C16H18OS and a molecular weight of 258.39 g/mol. Its IUPAC name is (1R,2R,5R)-1,5-dimethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene.
| Compound Name | (1R,2R,5R)-1,5-dimethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene |
|---|---|
| PubChem CID | 102367652 |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (1R,2R,5R)-1,5-dimethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene |
| SMILES | C=C1C[C@]2(C)C=C[C@@](C)(O2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C16H18OS/c1-12-11-15(2)9-10-16(3,17-15)14(12)18-13-7-5-4-6-8-13/h4-10,14H,1,11H2,2-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | HHJLMPGZROGSHK-OWCLPIDISA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|