C16H22OS — CID 42597013
(2S,3R,5S,6S)-3,5-dimethyl-2-phenylsulfanyl-6-prop-1-en-2-yloxane (PubChem CID 42597013) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is (2S,3R,5S,6S)-3,5-dimethyl-2-phenylsulfanyl-6-prop-1-en-2-yloxane.
| Compound Name | (2S,3R,5S,6S)-3,5-dimethyl-2-phenylsulfanyl-6-prop-1-en-2-yloxane |
|---|---|
| PubChem CID | 42597013 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2S,3R,5S,6S)-3,5-dimethyl-2-phenylsulfanyl-6-prop-1-en-2-yloxane |
| SMILES | C=C(C)[C@H]1O[C@@H](Sc2ccccc2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C16H22OS/c1-11(2)15-12(3)10-13(4)16(17-15)18-14-8-6-5-7-9-14/h5-9,12-13,15-16H,1,10H2,2-4H3/t12-,13+,15+,16-/m0/s1 |
| InChIKey | VWVRLDRXMAKNQK-XNISGKROSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|