C19H25FOS — CID 142875620
2-[(1E,3E)-4-(2-fluoro-4-methylphenyl)buta-1,3-dienyl]-5-propan-2-ylsulfanyloxane (PubChem CID 142875620) has the molecular formula C19H25FOS and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(2-fluoro-4-methylphenyl)buta-1,3-dienyl]-5-propan-2-ylsulfanyloxane.
| Compound Name | 2-[(1E,3E)-4-(2-fluoro-4-methylphenyl)buta-1,3-dienyl]-5-propan-2-ylsulfanyloxane |
|---|---|
| PubChem CID | 142875620 |
| Molecular Formula | C19H25FOS |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[(1E,3E)-4-(2-fluoro-4-methylphenyl)buta-1,3-dienyl]-5-propan-2-ylsulfanyloxane |
| SMILES | Cc1ccc(/C=C/C=C/C2CCC(SC(C)C)CO2)c(F)c1 |
| InChI | InChI=1S/C19H25FOS/c1-14(2)22-18-11-10-17(21-13-18)7-5-4-6-16-9-8-15(3)12-19(16)20/h4-9,12,14,17-18H,10-11,13H2,1-3H3/b6-4+,7-5+ |
| InChIKey | FWRHCESYGUMKIB-YDFGWWAZSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|