C15H17F3OS — CID 20693008
5-methylsulfanyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxane (PubChem CID 20693008) has the molecular formula C15H17F3OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxane.
| Compound Name | 5-methylsulfanyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxane |
|---|---|
| PubChem CID | 20693008 |
| Molecular Formula | C15H17F3OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-methylsulfanyl-2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxane |
| SMILES | CSC1CCC(/C=C/c2ccc(C(F)(F)F)cc2)OC1 |
| InChI | InChI=1S/C15H17F3OS/c1-20-14-9-8-13(19-10-14)7-4-11-2-5-12(6-3-11)15(16,17)18/h2-7,13-14H,8-10H2,1H3/b7-4+ |
| InChIKey | OILLFMCWWBOSIF-QPJJXVBHSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |