C15H12F6OS — CID 142769198
(1R,4S)-1-(benzylsulfanylmethyl)-5,5,6-trifluoro-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 142769198) has the molecular formula C15H12F6OS and a molecular weight of 354.32 g/mol. Its IUPAC name is (1R,4S)-1-(benzylsulfanylmethyl)-5,5,6-trifluoro-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S)-1-(benzylsulfanylmethyl)-5,5,6-trifluoro-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 142769198 |
| Molecular Formula | C15H12F6OS |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (1R,4S)-1-(benzylsulfanylmethyl)-5,5,6-trifluoro-6-(trifluoromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1(F)C(F)(F)[C@@H]2C=C[C@@]1(CSCc1ccccc1)O2 |
| InChI | InChI=1S/C15H12F6OS/c16-13(17)11-6-7-12(22-11,14(13,18)15(19,20)21)9-23-8-10-4-2-1-3-5-10/h1-7,11H,8-9H2/t11-,12-,14?/m0/s1 |
| InChIKey | RHRRKJGDPLGOLZ-VHBIQUBJSA-N |
| XLogP | 4.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|