C24H34OS — CID 102367651
(1R,2R,5R)-3-methylidene-1,5-dipentyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene (PubChem CID 102367651) has the molecular formula C24H34OS and a molecular weight of 370.60 g/mol. Its IUPAC name is (1R,2R,5R)-3-methylidene-1,5-dipentyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene.
| Compound Name | (1R,2R,5R)-3-methylidene-1,5-dipentyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene |
|---|---|
| PubChem CID | 102367651 |
| Molecular Formula | C24H34OS |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (1R,2R,5R)-3-methylidene-1,5-dipentyl-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene |
| SMILES | C=C1C[C@]2(CCCCC)C=C[C@@](CCCCC)(O2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C24H34OS/c1-4-6-11-15-23-17-18-24(25-23,16-12-7-5-2)22(20(3)19-23)26-21-13-9-8-10-14-21/h8-10,13-14,17-18,22H,3-7,11-12,15-16,19H2,1-2H3/t22-,23+,24-/m1/s1 |
| InChIKey | HDTSLVUWXXCRSA-TZRRMPRUSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|