C18H22OS — CID 102367653
(1R,2R,5R)-1,5-diethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene (PubChem CID 102367653) has the molecular formula C18H22OS and a molecular weight of 286.44 g/mol. Its IUPAC name is (1R,2R,5R)-1,5-diethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene.
| Compound Name | (1R,2R,5R)-1,5-diethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene |
|---|---|
| PubChem CID | 102367653 |
| Molecular Formula | C18H22OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (1R,2R,5R)-1,5-diethyl-3-methylidene-2-phenylsulfanyl-8-oxabicyclo[3.2.1]oct-6-ene |
| SMILES | C=C1C[C@]2(CC)C=C[C@@](CC)(O2)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C18H22OS/c1-4-17-11-12-18(5-2,19-17)16(14(3)13-17)20-15-9-7-6-8-10-15/h6-12,16H,3-5,13H2,1-2H3/t16-,17+,18-/m1/s1 |
| InChIKey | UXQSYPFEAYERRU-FGTMMUONSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|