C28H48OSSn — CID 11954585
tributyl-[2-[(2S,3S,5R,6S)-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]prop-2-enyl]stannane (PubChem CID 11954585) has the molecular formula C28H48OSSn and a molecular weight of 551.47 g/mol. Its IUPAC name is tributyl-[2-[(2S,3S,5R,6S)-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]prop-2-enyl]stannane.
| Compound Name | tributyl-[2-[(2S,3S,5R,6S)-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]prop-2-enyl]stannane |
|---|---|
| PubChem CID | 11954585 |
| Molecular Formula | C28H48OSSn |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | tributyl-[2-[(2S,3S,5R,6S)-3,5-dimethyl-6-phenylsulfanyloxan-2-yl]prop-2-enyl]stannane |
| SMILES | C=C(C[Sn](CCCC)(CCCC)CCCC)[C@H]1O[C@@H](Sc2ccccc2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C16H21OS.3C4H9.Sn/c1-11(2)15-12(3)10-13(4)16(17-15)18-14-8-6-5-7-9-14;3*1-3-4-2;/h5-9,12-13,15-16H,1-2,10H2,3-4H3;3*1,3-4H2,2H3;/t12-,13+,15+,16-;;;;/m0..../s1 |
| InChIKey | JWNHJNSDBLRGKF-ADNIJUCISA-N |
| XLogP | 9.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|