C14H18OS — CID 134931452
[(1R,5R)-5-methoxycyclohex-3-en-1-yl]methylsulfanylbenzene (PubChem CID 134931452) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is [(1R,5R)-5-methoxycyclohex-3-en-1-yl]methylsulfanylbenzene.
| Compound Name | [(1R,5R)-5-methoxycyclohex-3-en-1-yl]methylsulfanylbenzene |
|---|---|
| PubChem CID | 134931452 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [(1R,5R)-5-methoxycyclohex-3-en-1-yl]methylsulfanylbenzene |
| SMILES | CO[C@H]1C=CC[C@@H](CSc2ccccc2)C1 |
| InChI | InChI=1S/C14H18OS/c1-15-13-7-5-6-12(10-13)11-16-14-8-3-2-4-9-14/h2-5,7-9,12-13H,6,10-11H2,1H3/t12-,13+/m1/s1 |
| InChIKey | DVSSRZYNUCOLBE-OLZOCXBDSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|