C102H144O15 — CID 101271590
didecyl 6-[3,5-bis[[1,3-bis(decoxycarbonyl)azulen-6-yl]oxy]phenoxy]azulene-1,3-dicarboxylate (PubChem CID 101271590) has the molecular formula C102H144O15 and a molecular weight of 1610.26 g/mol. Its IUPAC name is didecyl 6-[3,5-bis[[1,3-bis(decoxycarbonyl)azulen-6-yl]oxy]phenoxy]azulene-1,3-dicarboxylate.
| Compound Name | didecyl 6-[3,5-bis[[1,3-bis(decoxycarbonyl)azulen-6-yl]oxy]phenoxy]azulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101271590 |
| Molecular Formula | C102H144O15 |
| Molecular Weight | 1610.26 g/mol |
| Exact Mass | 1609.05 |
| IUPAC Name | didecyl 6-[3,5-bis[[1,3-bis(decoxycarbonyl)azulen-6-yl]oxy]phenoxy]azulene-1,3-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1cc(C(=O)OCCCCCCCCCC)c2ccc(Oc3cc(Oc4ccc5c(C(=O)OCCCCCCCCCC)cc(C(=O)OCCCCCCCCCC)c-5cc4)cc(Oc4ccc5c(C(=O)OCCCCCCCCCC)cc(C(=O)OCCCCCCCCCC)c-5cc4)c3)ccc1-2 |
| InChI | InChI=1S/C102H144O15/c1-7-13-19-25-31-37-43-49-67-109-97(103)91-76-92(98(104)110-68-50-44-38-32-26-20-14-8-2)86-62-56-79(55-61-85(86)91)115-82-73-83(116-80-57-63-87-88(64-58-80)94(100(106)112-70-52-46-40-34-28-22-16-10-4)77-93(87)99(105)111-69-51-45-39-33-27-21-15-9-3)75-84(74-82)117-81-59-65-89-90(66-60-81)96(102(108)114-72-54-48-42-36-30-24-18-12-6)78-95(89)101(107)113-71-53-47-41-35-29-23-17-11-5/h55-66,73-78H,7-54,67-72H2,1-6H3 |
| InChIKey | FUPIXRLBTFNVHC-UHFFFAOYSA-N |
| XLogP | 30.16 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 66 |
| Heavy Atoms | 117 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1610.26 |
| LogP ≤ 5 | 30.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|