C22H20N2O4 — CID 101271902
5-(5-carboxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3-carboxylic acid (PubChem CID 101271902) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-(5-carboxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3-carboxylic acid.
| Compound Name | 5-(5-carboxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 101271902 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-(5-carboxy-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-trien-3-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(-c2[nH]c(C(=O)O)c3c2C2C=CC3CC2)c2c1C1C=CC2CC1 |
| InChI | InChI=1S/C22H20N2O4/c25-21(26)19-15-11-5-1-9(2-6-11)13(15)17(23-19)18-14-10-3-7-12(8-4-10)16(14)20(24-18)22(27)28/h1,3,5,7,9-12,23-24H,2,4,6,8H2,(H,25,26)(H,27,28) |
| InChIKey | HXKHDBYLWPNXFR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|