C30H37N3O10 — CID 101272029
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]oxan-2-yl]methyl acetate (PubChem CID 101272029) has the molecular formula C30H37N3O10 and a molecular weight of 599.64 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101272029 |
| Molecular Formula | C30H37N3O10 |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[[4-(diethylamino)phenyl]diazenyl]phenoxy]oxan-2-yl]methyl acetate |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(O[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C30H37N3O10/c1-7-33(8-2)24-13-9-22(10-14-24)31-32-23-11-15-25(16-12-23)42-30-29(41-21(6)37)28(40-20(5)36)27(39-19(4)35)26(43-30)17-38-18(3)34/h9-16,26-30H,7-8,17H2,1-6H3/b32-31+/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | FNTFJNNBLPGZHO-JXAVSJJTSA-N |
| XLogP | 4.41 |
| TPSA | 151.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|