C29H37N3O4 — CID 101272937
4-[[2,4-bis(6-ethenoxyhexoxy)phenyl]diazenyl]benzonitrile (PubChem CID 101272937) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 4-[[2,4-bis(6-ethenoxyhexoxy)phenyl]diazenyl]benzonitrile.
| Compound Name | 4-[[2,4-bis(6-ethenoxyhexoxy)phenyl]diazenyl]benzonitrile |
|---|---|
| PubChem CID | 101272937 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 4-[[2,4-bis(6-ethenoxyhexoxy)phenyl]diazenyl]benzonitrile |
| SMILES | C=COCCCCCCOc1ccc(/N=N/c2ccc(C#N)cc2)c(OCCCCCCOC=C)c1 |
| InChI | InChI=1S/C29H37N3O4/c1-3-33-19-9-5-7-11-21-35-27-17-18-28(32-31-26-15-13-25(24-30)14-16-26)29(23-27)36-22-12-8-6-10-20-34-4-2/h3-4,13-18,23H,1-2,5-12,19-22H2/b32-31+ |
| InChIKey | FOAWVXJYCSVMRJ-QNEJGDQOSA-N |
| XLogP | 8.17 |
| TPSA | 85.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|