C14H18O — CID 101273970
1-[2-[(2E)-2-ethylidenecyclopropyl]ethyl]-4-methoxybenzene (PubChem CID 101273970) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[2-[(2E)-2-ethylidenecyclopropyl]ethyl]-4-methoxybenzene.
| Compound Name | 1-[2-[(2E)-2-ethylidenecyclopropyl]ethyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 101273970 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-[2-[(2E)-2-ethylidenecyclopropyl]ethyl]-4-methoxybenzene |
| SMILES | C/C=C1\CC1CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H18O/c1-3-12-10-13(12)7-4-11-5-8-14(15-2)9-6-11/h3,5-6,8-9,13H,4,7,10H2,1-2H3/b12-3+ |
| InChIKey | UHDRBSCZJIXLEX-KGVSQERTSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|