C19H26O — CID 158701742
2-[2-(4-methoxyphenyl)ethyl]adamantane (PubChem CID 158701742) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]adamantane.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]adamantane |
|---|---|
| PubChem CID | 158701742 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]adamantane |
| SMILES | COc1ccc(CCC2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C19H26O/c1-20-18-5-2-13(3-6-18)4-7-19-16-9-14-8-15(11-16)12-17(19)10-14/h2-3,5-6,14-17,19H,4,7-12H2,1H3 |
| InChIKey | IHPXRZIENKCIKB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |