C20H26O2 — CID 135008863
1-(1-adamantyl)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 135008863) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 1-(1-adamantyl)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 135008863 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-(1-adamantyl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H26O2/c1-22-18-5-2-14(3-6-18)4-7-19(21)20-11-15-8-16(12-20)10-17(9-15)13-20/h2-3,5-6,15-17H,4,7-13H2,1H3 |
| InChIKey | CSNDATOEQFKIMC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |