C18H24O3S — CID 167898856
1-[(4-methoxyphenyl)methylsulfonyl]adamantane (PubChem CID 167898856) has the molecular formula C18H24O3S and a molecular weight of 320.45 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methylsulfonyl]adamantane.
| Compound Name | 1-[(4-methoxyphenyl)methylsulfonyl]adamantane |
|---|---|
| PubChem CID | 167898856 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methylsulfonyl]adamantane |
| SMILES | COc1ccc(CS(=O)(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H24O3S/c1-21-17-4-2-13(3-5-17)12-22(19,20)18-9-14-6-15(10-18)8-16(7-14)11-18/h2-5,14-16H,6-12H2,1H3 |
| InChIKey | VHWYEMYPXKFMLN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |