C19H26N2O5S — CID 71462975
2-[1-adamantyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxyacetamide (PubChem CID 71462975) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[1-adamantyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxyacetamide.
| Compound Name | 2-[1-adamantyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 71462975 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[1-adamantyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxyacetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NO)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H26N2O5S/c1-26-16-2-4-17(5-3-16)27(24,25)21(12-18(22)20-23)19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,13-15,23H,6-12H2,1H3,(H,20,22) |
| InChIKey | YRNDCSSKXRTPOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|