C16H25N3O5S — CID 22907189
N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(1-piperidin-2-ylethyl)amino]acetamide (PubChem CID 22907189) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(1-piperidin-2-ylethyl)amino]acetamide.
| Compound Name | N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(1-piperidin-2-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 22907189 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-hydroxy-2-[(4-methoxyphenyl)sulfonyl-(1-piperidin-2-ylethyl)amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NO)C(C)C2CCCCN2)cc1 |
| InChI | InChI=1S/C16H25N3O5S/c1-12(15-5-3-4-10-17-15)19(11-16(20)18-21)25(22,23)14-8-6-13(24-2)7-9-14/h6-9,12,15,17,21H,3-5,10-11H2,1-2H3,(H,18,20) |
| InChIKey | XBRQYQJJOBMRED-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|