About CID 101274523
CID 101274523 (PubChem CID 101274523) has the molecular formula C11H22NO3
and a molecular weight of 216.30 g/mol.
Molecular Properties
| Compound Name | CID 101274523 |
| PubChem CID | 101274523 |
| Molecular Formula | C11H22NO3 |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | — |
| SMILES | CC[C@]1(CO)CCC[C@@](CC)(CO)N1[O] |
| InChI | InChI=1S/C11H22NO3/c1-3-10(8-13)6-5-7-11(4-2,9-14)12(10)15/h13-14H,3-9H2,1-2H3/t10-,11+ |
| InChIKey | DHLFBVDVJBHZHO-PHIMTYICSA-N |
| XLogP | 1.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 101274523 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101274523?
The IUPAC name of CID 101274523 (CID 101274523) is not available.
What is the SMILES notation for CID 101274523?
The canonical SMILES for CID 101274523 is CC[C@]1(CO)CCC[C@@](CC)(CO)N1[O].
What is the InChIKey of CID 101274523?
The InChIKey is DHLFBVDVJBHZHO-PHIMTYICSA-N. The full InChI is InChI=1S/C11H22NO3/c1-3-10(8-13)6-5-7-11(4-2,9-14)12(10)15/h13-14H,3-9H2,1-2H3/t10-,11+.
What are the key properties of CID 101274523?
CID 101274523 has a molecular weight of 216.30 g/mol, XLogP of 1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101274523 is sourced from PubChem (CID 101274523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).