C11H25NO — CID 175130909
1,2,2-triethylpiperidine;hydrate (PubChem CID 175130909) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 1,2,2-triethylpiperidine;hydrate.
| Compound Name | 1,2,2-triethylpiperidine;hydrate |
|---|---|
| PubChem CID | 175130909 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 1,2,2-triethylpiperidine;hydrate |
| SMILES | CCN1CCCCC1(CC)CC.O |
| InChI | InChI=1S/C11H23N.H2O/c1-4-11(5-2)9-7-8-10-12(11)6-3;/h4-10H2,1-3H3;1H2 |
| InChIKey | XJUZETCXOIGCSN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |