C22H44NO3+ — CID 101276492
2-carboxypropyl-[(Z)-2-hydroxyoct-1-enyl]-dipentylazanium (PubChem CID 101276492) has the molecular formula C22H44NO3+ and a molecular weight of 370.60 g/mol. Its IUPAC name is 2-carboxypropyl-[(Z)-2-hydroxyoct-1-enyl]-dipentylazanium.
| Compound Name | 2-carboxypropyl-[(Z)-2-hydroxyoct-1-enyl]-dipentylazanium |
|---|---|
| PubChem CID | 101276492 |
| Molecular Formula | C22H44NO3+ |
| Molecular Weight | 370.60 g/mol |
| Exact Mass | 370.33 |
| IUPAC Name | 2-carboxypropyl-[(Z)-2-hydroxyoct-1-enyl]-dipentylazanium |
| SMILES | CCCCCC/C(O)=C/[N+](CCCCC)(CCCCC)CC(C)C(=O)O |
| InChI | InChI=1S/C22H43NO3/c1-5-8-11-12-15-21(24)19-23(16-13-9-6-2,17-14-10-7-3)18-20(4)22(25)26/h19-20H,5-18H2,1-4H3,(H-,24,25,26)/p+1/b21-19- |
| InChIKey | KADDOWNSIMXNJG-VZCXRCSSSA-O |
| XLogP | 6.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|