C23H46NO3+ — CID 101276662
4-carboxybutyl-[(E)-2-hydroxyoct-3-enyl]-dipentylazanium (PubChem CID 101276662) has the molecular formula C23H46NO3+ and a molecular weight of 384.63 g/mol. Its IUPAC name is 4-carboxybutyl-[(E)-2-hydroxyoct-3-enyl]-dipentylazanium.
| Compound Name | 4-carboxybutyl-[(E)-2-hydroxyoct-3-enyl]-dipentylazanium |
|---|---|
| PubChem CID | 101276662 |
| Molecular Formula | C23H46NO3+ |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.35 |
| IUPAC Name | 4-carboxybutyl-[(E)-2-hydroxyoct-3-enyl]-dipentylazanium |
| SMILES | CCCC/C=C/C(O)C[N+](CCCCC)(CCCCC)CCCCC(=O)O |
| InChI | InChI=1S/C23H45NO3/c1-4-7-10-11-16-22(25)21-24(18-13-8-5-2,19-14-9-6-3)20-15-12-17-23(26)27/h11,16,22,25H,4-10,12-15,17-21H2,1-3H3/p+1/b16-11+ |
| InChIKey | CKRDKQRDNGOSCE-LFIBNONCSA-O |
| XLogP | 5.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|