C13H26NO3+ — CID 101276711
1-carboxyethyl-[(E)-2-hydroxyoct-4-enyl]-dimethylazanium (PubChem CID 101276711) has the molecular formula C13H26NO3+ and a molecular weight of 244.35 g/mol. Its IUPAC name is 1-carboxyethyl-[(E)-2-hydroxyoct-4-enyl]-dimethylazanium.
| Compound Name | 1-carboxyethyl-[(E)-2-hydroxyoct-4-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 101276711 |
| Molecular Formula | C13H26NO3+ |
| Molecular Weight | 244.35 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-carboxyethyl-[(E)-2-hydroxyoct-4-enyl]-dimethylazanium |
| SMILES | CCC/C=C/CC(O)C[N+](C)(C)C(C)C(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-5-6-7-8-9-12(15)10-14(3,4)11(2)13(16)17/h7-8,11-12,15H,5-6,9-10H2,1-4H3/p+1/b8-7+ |
| InChIKey | LXXRLASVBCGDRI-BQYQJAHWSA-O |
| XLogP | 1.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|