C15H30NO3+ — CID 101276727
1-carboxyethyl-diethyl-[(E)-2-hydroxyoct-4-enyl]azanium (PubChem CID 101276727) has the molecular formula C15H30NO3+ and a molecular weight of 272.41 g/mol. Its IUPAC name is 1-carboxyethyl-diethyl-[(E)-2-hydroxyoct-4-enyl]azanium.
| Compound Name | 1-carboxyethyl-diethyl-[(E)-2-hydroxyoct-4-enyl]azanium |
|---|---|
| PubChem CID | 101276727 |
| Molecular Formula | C15H30NO3+ |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | 1-carboxyethyl-diethyl-[(E)-2-hydroxyoct-4-enyl]azanium |
| SMILES | CCC/C=C/CC(O)C[N+](CC)(CC)C(C)C(=O)O |
| InChI | InChI=1S/C15H29NO3/c1-5-8-9-10-11-14(17)12-16(6-2,7-3)13(4)15(18)19/h9-10,13-14,17H,5-8,11-12H2,1-4H3/p+1/b10-9+ |
| InChIKey | MEQPYDIZOMUZAK-MDZDMXLPSA-O |
| XLogP | 2.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|