C29H54O16 — CID 101276882
(2R,3S,4R,5R)-2,3,4,5-tetramethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal (PubChem CID 101276882) has the molecular formula C29H54O16 and a molecular weight of 658.73 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5-tetramethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5-tetramethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal |
|---|---|
| PubChem CID | 101276882 |
| Molecular Formula | C29H54O16 |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5-tetramethoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal |
| SMILES | COC[C@H]1O[C@H](OC[C@H]2O[C@H](OC[C@@H](OC)[C@@H](OC)[C@H](OC)[C@H](C=O)OC)[C@H](OC)[C@@H](OC)[C@H]2OC)[C@H](OC)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C29H54O16/c1-31-13-18-22(36-6)24(38-8)26(40-10)29(44-18)43-15-19-23(37-7)25(39-9)27(41-11)28(45-19)42-14-17(33-3)21(35-5)20(34-4)16(12-30)32-2/h12,16-29H,13-15H2,1-11H3/t16-,17+,18+,19+,20+,21+,22-,23-,24-,25-,26+,27+,28-,29-/m0/s1 |
| InChIKey | KILPSIXTALOEIK-NMIUKVSQSA-N |
| XLogP | -0.54 |
| TPSA | 155.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|